C19H18FN3O2S — CID 90609783
1-(6-fluoro-1,3-benzothiazol-2-yl)-N-(4-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 90609783) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-(6-fluoro-1,3-benzothiazol-2-yl)-N-(4-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(6-fluoro-1,3-benzothiazol-2-yl)-N-(4-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90609783 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-(6-fluoro-1,3-benzothiazol-2-yl)-N-(4-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)C1CCN(c2nc3ccc(F)cc3s2)CC1 |
| InChI | InChI=1S/C19H18FN3O2S/c20-13-1-6-16-17(11-13)26-19(22-16)23-9-7-12(8-10-23)18(25)21-14-2-4-15(24)5-3-14/h1-6,11-12,24H,7-10H2,(H,21,25) |
| InChIKey | KJLVDPMXBVLUHK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|