C18H16ClFN4OS — CID 90609907
N-(6-chloro-3-pyridinyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)piperidine-4-carboxamide (PubChem CID 90609907) has the molecular formula C18H16ClFN4OS and a molecular weight of 390.87 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | N-(6-chloro-3-pyridinyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90609907 |
| Molecular Formula | C18H16ClFN4OS |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)nc1)C1CCN(c2nc3ccc(F)cc3s2)CC1 |
| InChI | InChI=1S/C18H16ClFN4OS/c19-16-4-2-13(10-21-16)22-17(25)11-5-7-24(8-6-11)18-23-14-3-1-12(20)9-15(14)26-18/h1-4,9-11H,5-8H2,(H,22,25) |
| InChIKey | UWAHCGHOIDQBNI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|