C19H20N4O3S2 — CID 34043894
1-(1,3-benzothiazol-2-yl)-N-(4-sulfamoylphenyl)piperidine-4-carboxamide (PubChem CID 34043894) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-N-(4-sulfamoylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 34043894 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C2CCN(c3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C19H20N4O3S2/c20-28(25,26)15-7-5-14(6-8-15)21-18(24)13-9-11-23(12-10-13)19-22-16-3-1-2-4-17(16)27-19/h1-8,13H,9-12H2,(H,21,24)(H2,20,25,26) |
| InChIKey | JADUWHMZOBBDFU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |