C20H18N4OS — CID 90609420
1-(1,3-benzothiazol-2-yl)-N-(4-cyanophenyl)piperidine-4-carboxamide (PubChem CID 90609420) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-N-(4-cyanophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-N-(4-cyanophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90609420 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-N-(4-cyanophenyl)piperidine-4-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)C2CCN(c3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C20H18N4OS/c21-13-14-5-7-16(8-6-14)22-19(25)15-9-11-24(12-10-15)20-23-17-3-1-2-4-18(17)26-20/h1-8,15H,9-12H2,(H,22,25) |
| InChIKey | HHVBIIUWKKIUEC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |