C23H25N3O3S — CID 121128218
butyl 4-[[1-(6-methyl-1,3-benzothiazol-2-yl)azetidine-3-carbonyl]amino]benzoate (PubChem CID 121128218) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is butyl 4-[[1-(6-methyl-1,3-benzothiazol-2-yl)azetidine-3-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[1-(6-methyl-1,3-benzothiazol-2-yl)azetidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 121128218 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | butyl 4-[[1-(6-methyl-1,3-benzothiazol-2-yl)azetidine-3-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C2CN(c3nc4ccc(C)cc4s3)C2)cc1 |
| InChI | InChI=1S/C23H25N3O3S/c1-3-4-11-29-22(28)16-6-8-18(9-7-16)24-21(27)17-13-26(14-17)23-25-19-10-5-15(2)12-20(19)30-23/h5-10,12,17H,3-4,11,13-14H2,1-2H3,(H,24,27) |
| InChIKey | UEQOSKHVZMXHMP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|