C21H21N3O3S — CID 90610013
methyl 4-[[1-(1,3-benzothiazol-2-yl)piperidine-3-carbonyl]amino]benzoate (PubChem CID 90610013) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is methyl 4-[[1-(1,3-benzothiazol-2-yl)piperidine-3-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[1-(1,3-benzothiazol-2-yl)piperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 90610013 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | methyl 4-[[1-(1,3-benzothiazol-2-yl)piperidine-3-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CCCN(c3nc4ccccc4s3)C2)cc1 |
| InChI | InChI=1S/C21H21N3O3S/c1-27-20(26)14-8-10-16(11-9-14)22-19(25)15-5-4-12-24(13-15)21-23-17-6-2-3-7-18(17)28-21/h2-3,6-11,15H,4-5,12-13H2,1H3,(H,22,25) |
| InChIKey | CONIEYSMDCXORD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |