C16H21N3O2S — CID 90609959
1-(1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide (PubChem CID 90609959) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90609959 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-N-(2-methoxyethyl)piperidine-3-carboxamide |
| SMILES | COCCNC(=O)C1CCCN(c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C16H21N3O2S/c1-21-10-8-17-15(20)12-5-4-9-19(11-12)16-18-13-6-2-3-7-14(13)22-16/h2-3,6-7,12H,4-5,8-11H2,1H3,(H,17,20) |
| InChIKey | NMIGMEVSVRNTNH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|