C17H24N4O2S — CID 7455185
1-[(3R)-1-(1,3-benzothiazol-2-yl)piperidin-3-yl]-3-(3-methoxypropyl)urea (PubChem CID 7455185) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-[(3R)-1-(1,3-benzothiazol-2-yl)piperidin-3-yl]-3-(3-methoxypropyl)urea.
| Compound Name | 1-[(3R)-1-(1,3-benzothiazol-2-yl)piperidin-3-yl]-3-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 7455185 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[(3R)-1-(1,3-benzothiazol-2-yl)piperidin-3-yl]-3-(3-methoxypropyl)urea |
| SMILES | COCCCNC(=O)N[C@@H]1CCCN(c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C17H24N4O2S/c1-23-11-5-9-18-16(22)19-13-6-4-10-21(12-13)17-20-14-7-2-3-8-15(14)24-17/h2-3,7-8,13H,4-6,9-12H2,1H3,(H2,18,19,22)/t13-/m1/s1 |
| InChIKey | WFBICXQMLZRPMI-CYBMUJFWSA-N |
| XLogP | 2.60 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|