C22H24N4O2S — CID 51950754
(3S)-N-(2-benzamidoethyl)-1-(1,3-benzothiazol-2-yl)piperidine-3-carboxamide (PubChem CID 51950754) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is (3S)-N-(2-benzamidoethyl)-1-(1,3-benzothiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2-benzamidoethyl)-1-(1,3-benzothiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 51950754 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (3S)-N-(2-benzamidoethyl)-1-(1,3-benzothiazol-2-yl)piperidine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)[C@H]1CCCN(c2nc3ccccc3s2)C1)c1ccccc1 |
| InChI | InChI=1S/C22H24N4O2S/c27-20(16-7-2-1-3-8-16)23-12-13-24-21(28)17-9-6-14-26(15-17)22-25-18-10-4-5-11-19(18)29-22/h1-5,7-8,10-11,17H,6,9,12-15H2,(H,23,27)(H,24,28)/t17-/m0/s1 |
| InChIKey | CLZZAQZWSIIDGM-KRWDZBQOSA-N |
| XLogP | 3.06 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|