C19H18Cl2N4OS — CID 97018001
(3R)-N-(4-amino-3,5-dichlorophenyl)-1-(1,3-benzothiazol-2-yl)piperidine-3-carboxamide (PubChem CID 97018001) has the molecular formula C19H18Cl2N4OS and a molecular weight of 421.35 g/mol. Its IUPAC name is (3R)-N-(4-amino-3,5-dichlorophenyl)-1-(1,3-benzothiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(4-amino-3,5-dichlorophenyl)-1-(1,3-benzothiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97018001 |
| Molecular Formula | C19H18Cl2N4OS |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | (3R)-N-(4-amino-3,5-dichlorophenyl)-1-(1,3-benzothiazol-2-yl)piperidine-3-carboxamide |
| SMILES | Nc1c(Cl)cc(NC(=O)[C@@H]2CCCN(c3nc4ccccc4s3)C2)cc1Cl |
| InChI | InChI=1S/C19H18Cl2N4OS/c20-13-8-12(9-14(21)17(13)22)23-18(26)11-4-3-7-25(10-11)19-24-15-5-1-2-6-16(15)27-19/h1-2,5-6,8-9,11H,3-4,7,10,22H2,(H,23,26)/t11-/m1/s1 |
| InChIKey | CXPQRPCSJBCJME-LLVKDONJSA-N |
| XLogP | 5.04 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|