C21H26N4O4S — CID 16909772
1-[2-(4-methylanilino)-2-oxoethyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide (PubChem CID 16909772) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 1-[2-(4-methylanilino)-2-oxoethyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(4-methylanilino)-2-oxoethyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16909772 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-[2-(4-methylanilino)-2-oxoethyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)CN2CCC(C(=O)Nc3ccc(S(N)(=O)=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H26N4O4S/c1-15-2-4-17(5-3-15)23-20(26)14-25-12-10-16(11-13-25)21(27)24-18-6-8-19(9-7-18)30(22,28)29/h2-9,16H,10-14H2,1H3,(H,23,26)(H,24,27)(H2,22,28,29) |
| InChIKey | AUOOHVWLLAFECV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |