C17H24N4O3S — CID 51260859
1-(4-cyanobutyl)-N-(4-sulfamoylphenyl)piperidine-4-carboxamide (PubChem CID 51260859) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 1-(4-cyanobutyl)-N-(4-sulfamoylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-cyanobutyl)-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51260859 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-(4-cyanobutyl)-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
| SMILES | N#CCCCCN1CCC(C(=O)Nc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C17H24N4O3S/c18-10-2-1-3-11-21-12-8-14(9-13-21)17(22)20-15-4-6-16(7-5-15)25(19,23)24/h4-7,14H,1-3,8-9,11-13H2,(H,20,22)(H2,19,23,24) |
| InChIKey | BAGOWRTZBGWZAJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|