C23H28N4O6S — CID 47009647
1-[3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide (PubChem CID 47009647) has the molecular formula C23H28N4O6S and a molecular weight of 488.57 g/mol. Its IUPAC name is 1-[3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 47009647 |
| Molecular Formula | C23H28N4O6S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 1-[3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoyl]-N-(4-sulfamoylphenyl)piperidine-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C2CCN(C(=O)CCN3C(=O)C4CC=CCC4C3=O)CC2)cc1 |
| InChI | InChI=1S/C23H28N4O6S/c24-34(32,33)17-7-5-16(6-8-17)25-21(29)15-9-12-26(13-10-15)20(28)11-14-27-22(30)18-3-1-2-4-19(18)23(27)31/h1-2,5-8,15,18-19H,3-4,9-14H2,(H,25,29)(H2,24,32,33) |
| InChIKey | PXAQWTSKBNSGOH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|