C18H28N4O4S — CID 41134383
1-N-[(2S)-pentan-2-yl]-4-N-(4-sulfamoylphenyl)piperidine-1,4-dicarboxamide (PubChem CID 41134383) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-N-[(2S)-pentan-2-yl]-4-N-(4-sulfamoylphenyl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[(2S)-pentan-2-yl]-4-N-(4-sulfamoylphenyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 41134383 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-N-[(2S)-pentan-2-yl]-4-N-(4-sulfamoylphenyl)piperidine-1,4-dicarboxamide |
| SMILES | CCC[C@H](C)NC(=O)N1CCC(C(=O)Nc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C18H28N4O4S/c1-3-4-13(2)20-18(24)22-11-9-14(10-12-22)17(23)21-15-5-7-16(8-6-15)27(19,25)26/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,20,24)(H,21,23)(H2,19,25,26)/t13-/m0/s1 |
| InChIKey | HGFPKHGBSRWXDZ-ZDUSSCGKSA-N |
| XLogP | 1.88 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |