C17H25N3O5S — CID 24588628
ethyl 1-[3-oxo-3-(4-sulfamoylanilino)propyl]piperidine-4-carboxylate (PubChem CID 24588628) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is ethyl 1-[3-oxo-3-(4-sulfamoylanilino)propyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-oxo-3-(4-sulfamoylanilino)propyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 24588628 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | ethyl 1-[3-oxo-3-(4-sulfamoylanilino)propyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CCC(=O)Nc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C17H25N3O5S/c1-2-25-17(22)13-7-10-20(11-8-13)12-9-16(21)19-14-3-5-15(6-4-14)26(18,23)24/h3-6,13H,2,7-12H2,1H3,(H,19,21)(H2,18,23,24) |
| InChIKey | LXHYCOHPVTXVHQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |