C35H51N5O6 — CID 22836509
butyl (NZ)-N-[amino-[4-[3-[1-[3-[4-[(Z)-N'-butoxycarbonylcarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]methylidene]carbamate (PubChem CID 22836509) has the molecular formula C35H51N5O6 and a molecular weight of 637.82 g/mol. Its IUPAC name is butyl (NZ)-N-[amino-[4-[3-[1-[3-[4-[(Z)-N'-butoxycarbonylcarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]methylidene]carbamate.
| Compound Name | butyl (NZ)-N-[amino-[4-[3-[1-[3-[4-[(Z)-N'-butoxycarbonylcarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 22836509 |
| Molecular Formula | C35H51N5O6 |
| Molecular Weight | 637.82 g/mol |
| Exact Mass | 637.38 |
| IUPAC Name | butyl (NZ)-N-[amino-[4-[3-[1-[3-[4-[(Z)-N'-butoxycarbonylcarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]methylidene]carbamate |
| SMILES | CCCCOC(=O)/N=C(\N)c1ccc(OCCCC2CCN(CCCOc3ccc(/C(N)=N/C(=O)OCCCC)cc3)CC2)cc1 |
| InChI | InChI=1S/C35H51N5O6/c1-3-5-23-45-34(41)38-32(36)28-10-14-30(15-11-28)43-25-7-9-27-18-21-40(22-19-27)20-8-26-44-31-16-12-29(13-17-31)33(37)39-35(42)46-24-6-4-2/h10-17,27H,3-9,18-26H2,1-2H3,(H2,36,38,41)(H2,37,39,42) |
| InChIKey | DAIADFNENUPDES-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.82 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|