C31H43N5O6 — CID 87541200
[1-[[amino-[4-[3-[1-[3-(4-carbamoylphenoxy)propyl]piperidin-4-yl]propoxy]phenyl]methylidene]amino]oxypropylideneamino] propanoate (PubChem CID 87541200) has the molecular formula C31H43N5O6 and a molecular weight of 581.71 g/mol. Its IUPAC name is [1-[[amino-[4-[3-[1-[3-(4-carbamoylphenoxy)propyl]piperidin-4-yl]propoxy]phenyl]methylidene]amino]oxypropylideneamino] propanoate.
| Compound Name | [1-[[amino-[4-[3-[1-[3-(4-carbamoylphenoxy)propyl]piperidin-4-yl]propoxy]phenyl]methylidene]amino]oxypropylideneamino] propanoate |
|---|---|
| PubChem CID | 87541200 |
| Molecular Formula | C31H43N5O6 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | [1-[[amino-[4-[3-[1-[3-(4-carbamoylphenoxy)propyl]piperidin-4-yl]propoxy]phenyl]methylidene]amino]oxypropylideneamino] propanoate |
| SMILES | CCC(=O)ON=C(CC)ON=C(N)c1ccc(OCCCC2CCN(CCCOc3ccc(C(N)=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H43N5O6/c1-3-28(34-42-29(37)4-2)41-35-30(32)24-8-12-26(13-9-24)39-21-5-7-23-16-19-36(20-17-23)18-6-22-40-27-14-10-25(11-15-27)31(33)38/h8-15,23H,3-7,16-22H2,1-2H3,(H2,32,35)(H2,33,38) |
| InChIKey | XPQJCBKNSZVRBA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|