C37H57N7O6 — CID 91345891
[[amino-[4-[3-[1-[3-[4-[N'-[(2S)-2-amino-4-methylpentanoyl]oxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]methylidene]amino] (2S)-2-amino-4-methylpentanoate (PubChem CID 91345891) has the molecular formula C37H57N7O6 and a molecular weight of 695.91 g/mol. Its IUPAC name is [[amino-[4-[3-[1-[3-[4-[N'-[(2S)-2-amino-4-methylpentanoyl]oxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]methylidene]amino] (2S)-2-amino-4-methylpentanoate.
| Compound Name | [[amino-[4-[3-[1-[3-[4-[N'-[(2S)-2-amino-4-methylpentanoyl]oxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]methylidene]amino] (2S)-2-amino-4-methylpentanoate |
|---|---|
| PubChem CID | 91345891 |
| Molecular Formula | C37H57N7O6 |
| Molecular Weight | 695.91 g/mol |
| Exact Mass | 695.44 |
| IUPAC Name | [[amino-[4-[3-[1-[3-[4-[N'-[(2S)-2-amino-4-methylpentanoyl]oxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]methylidene]amino] (2S)-2-amino-4-methylpentanoate |
| SMILES | CC(C)C[C@H](N)C(=O)ON=C(N)c1ccc(OCCCC2CCN(CCCOc3ccc(C(N)=NOC(=O)[C@@H](N)CC(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C37H57N7O6/c1-25(2)23-32(38)36(45)49-42-34(40)28-8-12-30(13-9-28)47-21-5-7-27-16-19-44(20-17-27)18-6-22-48-31-14-10-29(11-15-31)35(41)43-50-37(46)33(39)24-26(3)4/h8-15,25-27,32-33H,5-7,16-24,38-39H2,1-4H3,(H2,40,42)(H2,41,43)/t32-,33-/m0/s1 |
| InChIKey | FAAVMQILIYBCLS-LQJZCPKCSA-N |
| XLogP | 4.10 |
| TPSA | 203.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.91 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|