C33H41N5O5 — CID 172934080
benzyl N-[amino-[4-[3-[1-[3-[4-[(E)-N'-hydroxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]methylidene]carbamate (PubChem CID 172934080) has the molecular formula C33H41N5O5 and a molecular weight of 587.72 g/mol. Its IUPAC name is benzyl N-[amino-[4-[3-[1-[3-[4-[(E)-N'-hydroxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[4-[3-[1-[3-[4-[(E)-N'-hydroxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 172934080 |
| Molecular Formula | C33H41N5O5 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | benzyl N-[amino-[4-[3-[1-[3-[4-[(E)-N'-hydroxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]methylidene]carbamate |
| SMILES | NC(=NC(=O)OCc1ccccc1)c1ccc(OCCCC2CCN(CCCOc3ccc(/C(N)=N\O)cc3)CC2)cc1 |
| InChI | InChI=1S/C33H41N5O5/c34-31(36-33(39)43-24-26-6-2-1-3-7-26)27-9-13-29(14-10-27)41-22-4-8-25-17-20-38(21-18-25)19-5-23-42-30-15-11-28(12-16-30)32(35)37-40/h1-3,6-7,9-16,25,40H,4-5,8,17-24H2,(H2,35,37)(H2,34,36,39) |
| InChIKey | XUUYVIRYBCYGLT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|