C19H20N2O5 — CID 23371400
4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid (PubChem CID 23371400) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 23371400 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid |
| SMILES | N/C(=N/C(=O)OCc1ccccc1)c1ccc(OCCCC(=O)O)cc1 |
| InChI | InChI=1S/C19H20N2O5/c20-18(21-19(24)26-13-14-5-2-1-3-6-14)15-8-10-16(11-9-15)25-12-4-7-17(22)23/h1-3,5-6,8-11H,4,7,12-13H2,(H,22,23)(H2,20,21,24) |
| InChIKey | VWANJIMLWGPYFT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|