About 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid
4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid (PubChem CID 23371400) has the molecular formula C19H20N2O5
and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid.
Molecular Properties
| Compound Name | 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid |
| PubChem CID | 23371400 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid |
| SMILES | N/C(=N/C(=O)OCc1ccccc1)c1ccc(OCCCC(=O)O)cc1 |
| InChI | InChI=1S/C19H20N2O5/c20-18(21-19(24)26-13-14-5-2-1-3-6-14)15-8-10-16(11-9-15)25-12-4-7-17(22)23/h1-3,5-6,8-11H,4,7,12-13H2,(H,22,23)(H2,20,21,24) |
| InChIKey | VWANJIMLWGPYFT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid?
The IUPAC name of 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid (CID 23371400) is 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid.
What is the SMILES notation for 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid?
The canonical SMILES for 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid is N/C(=N/C(=O)OCc1ccccc1)c1ccc(OCCCC(=O)O)cc1.
What is the InChIKey of 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid?
The InChIKey is VWANJIMLWGPYFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O5/c20-18(21-19(24)26-13-14-5-2-1-3-6-14)15-8-10-16(11-9-15)25-12-4-7-17(22)23/h1-3,5-6,8-11H,4,7,12-13H2,(H,22,23)(H2,20,21,24).
What are the key properties of 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid?
4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid has a molecular weight of 356.38 g/mol, XLogP of 2.97, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenoxy]butanoic acid is sourced from PubChem (CID 23371400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).