C27H39N5O3 — CID 59869047
4-[3-[1-[3-[4-[(Z)-N'-methoxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]-N'-methylbenzenecarboximidamide (PubChem CID 59869047) has the molecular formula C27H39N5O3 and a molecular weight of 481.64 g/mol. Its IUPAC name is 4-[3-[1-[3-[4-[(Z)-N'-methoxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]-N'-methylbenzenecarboximidamide.
| Compound Name | 4-[3-[1-[3-[4-[(Z)-N'-methoxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 59869047 |
| Molecular Formula | C27H39N5O3 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.31 |
| IUPAC Name | 4-[3-[1-[3-[4-[(Z)-N'-methoxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(\N)c1ccc(OCCCC2CCN(CCCOc3ccc(/C(N)=N/OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H39N5O3/c1-30-26(28)22-6-10-24(11-7-22)34-19-3-5-21-14-17-32(18-15-21)16-4-20-35-25-12-8-23(9-13-25)27(29)31-33-2/h6-13,21H,3-5,14-20H2,1-2H3,(H2,28,30)(H2,29,31) |
| InChIKey | AGYJFOUJSADLRT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|