C25H34N2O2 — CID 143655823
1-[4-[3-[1-(3-phenoxypropyl)piperidin-4-yl]propoxy]phenyl]ethanimine (PubChem CID 143655823) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-[4-[3-[1-(3-phenoxypropyl)piperidin-4-yl]propoxy]phenyl]ethanimine.
| Compound Name | 1-[4-[3-[1-(3-phenoxypropyl)piperidin-4-yl]propoxy]phenyl]ethanimine |
|---|---|
| PubChem CID | 143655823 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 1-[4-[3-[1-(3-phenoxypropyl)piperidin-4-yl]propoxy]phenyl]ethanimine |
| SMILES | [H]/N=C(\C)c1ccc(OCCCC2CCN(CCCOc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H34N2O2/c1-21(26)23-10-12-25(13-11-23)28-19-5-7-22-14-17-27(18-15-22)16-6-20-29-24-8-3-2-4-9-24/h2-4,8-13,22,26H,5-7,14-20H2,1H3/b26-21+ |
| InChIKey | KGJJBLPERFKHOO-YYADALCUSA-N |
| XLogP | 5.41 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|