C29H39N5O6 — CID 59263022
[(Z)-[[4-[3-[1-[3-[4-[(Z)-N'-acetyloxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]-aminomethylidene]amino] acetate (PubChem CID 59263022) has the molecular formula C29H39N5O6 and a molecular weight of 553.66 g/mol. Its IUPAC name is [(Z)-[[4-[3-[1-[3-[4-[(Z)-N'-acetyloxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]-aminomethylidene]amino] acetate.
| Compound Name | [(Z)-[[4-[3-[1-[3-[4-[(Z)-N'-acetyloxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]-aminomethylidene]amino] acetate |
|---|---|
| PubChem CID | 59263022 |
| Molecular Formula | C29H39N5O6 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | [(Z)-[[4-[3-[1-[3-[4-[(Z)-N'-acetyloxycarbamimidoyl]phenoxy]propyl]piperidin-4-yl]propoxy]phenyl]-aminomethylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\N)c1ccc(OCCCC2CCN(CCCOc3ccc(/C(N)=N/OC(C)=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H39N5O6/c1-21(35)39-32-28(30)24-6-10-26(11-7-24)37-19-3-5-23-14-17-34(18-15-23)16-4-20-38-27-12-8-25(9-13-27)29(31)33-40-22(2)36/h6-13,23H,3-5,14-20H2,1-2H3,(H2,30,32)(H2,31,33) |
| InChIKey | PZEVZIMJJDLZRT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|