C23H28N4O6 — CID 85065630
[[[4-[5-[4-(N'-acetyloxycarbamimidoyl)phenoxy]pentoxy]phenyl]-aminomethylidene]amino] acetate (PubChem CID 85065630) has the molecular formula C23H28N4O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is [[[4-[5-[4-(N'-acetyloxycarbamimidoyl)phenoxy]pentoxy]phenyl]-aminomethylidene]amino] acetate.
| Compound Name | [[[4-[5-[4-(N'-acetyloxycarbamimidoyl)phenoxy]pentoxy]phenyl]-aminomethylidene]amino] acetate |
|---|---|
| PubChem CID | 85065630 |
| Molecular Formula | C23H28N4O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | [[[4-[5-[4-(N'-acetyloxycarbamimidoyl)phenoxy]pentoxy]phenyl]-aminomethylidene]amino] acetate |
| SMILES | CC(=O)ON=C(N)c1ccc(OCCCCCOc2ccc(C(N)=NOC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C23H28N4O6/c1-16(28)32-26-22(24)18-6-10-20(11-7-18)30-14-4-3-5-15-31-21-12-8-19(9-13-21)23(25)27-33-17(2)29/h6-13H,3-5,14-15H2,1-2H3,(H2,24,26)(H2,25,27) |
| InChIKey | HPGYEORJAASNAX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|