C18H21N3O2 — CID 2908825
4-tert-butyl-N-[4-(N'-hydroxycarbamimidoyl)phenyl]benzamide (PubChem CID 2908825) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-(N'-hydroxycarbamimidoyl)phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-(N'-hydroxycarbamimidoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2908825 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4-tert-butyl-N-[4-(N'-hydroxycarbamimidoyl)phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(C(N)=NO)cc2)cc1 |
| InChI | InChI=1S/C18H21N3O2/c1-18(2,3)14-8-4-13(5-9-14)17(22)20-15-10-6-12(7-11-15)16(19)21-23/h4-11,23H,1-3H3,(H2,19,21)(H,20,22) |
| InChIKey | JFHCLZQABPCVGB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|