C11H11N5O2 — CID 55182109
N-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1H-pyrazole-4-carboxamide (PubChem CID 55182109) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is N-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55182109 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1H-pyrazole-4-carboxamide |
| SMILES | N/C(=N/O)c1ccc(NC(=O)c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C11H11N5O2/c12-10(16-18)7-1-3-9(4-2-7)15-11(17)8-5-13-14-6-8/h1-6,18H,(H2,12,16)(H,13,14)(H,15,17) |
| InChIKey | CPQGHMCXMDDKMV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|