C11H11N5O2 — CID 60786492
N-[4-(carbamoylamino)phenyl]-1H-pyrazole-4-carboxamide (PubChem CID 60786492) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is N-[4-(carbamoylamino)phenyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[4-(carbamoylamino)phenyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60786492 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N-[4-(carbamoylamino)phenyl]-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)Nc1ccc(NC(=O)c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C11H11N5O2/c12-11(18)16-9-3-1-8(2-4-9)15-10(17)7-5-13-14-6-7/h1-6H,(H,13,14)(H,15,17)(H3,12,16,18) |
| InChIKey | BHIKGKRHPJJLJW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |