C13H16N4O — CID 63085076
N-[4-[1-(methylamino)ethyl]phenyl]-1H-pyrazole-4-carboxamide (PubChem CID 63085076) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is N-[4-[1-(methylamino)ethyl]phenyl]-1H-pyrazole-4-carboxamide.
| Compound Name | N-[4-[1-(methylamino)ethyl]phenyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 63085076 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | N-[4-[1-(methylamino)ethyl]phenyl]-1H-pyrazole-4-carboxamide |
| SMILES | CNC(C)c1ccc(NC(=O)c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C13H16N4O/c1-9(14-2)10-3-5-12(6-4-10)17-13(18)11-7-15-16-8-11/h3-9,14H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | DRPHBXGNNSBWJI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |