C19H24Cl2N6O2 — CID 15954191
N,N'-bis(4-carbamimidoylphenyl)pentanediamide;dihydrochloride (PubChem CID 15954191) has the molecular formula C19H24Cl2N6O2 and a molecular weight of 439.35 g/mol. Its IUPAC name is N,N'-bis(4-carbamimidoylphenyl)pentanediamide;dihydrochloride.
| Compound Name | N,N'-bis(4-carbamimidoylphenyl)pentanediamide;dihydrochloride |
|---|---|
| PubChem CID | 15954191 |
| Molecular Formula | C19H24Cl2N6O2 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N,N'-bis(4-carbamimidoylphenyl)pentanediamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(NC(=O)CCCC(=O)Nc2ccc(/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C19H22N6O2.2ClH/c20-18(21)12-4-8-14(9-5-12)24-16(26)2-1-3-17(27)25-15-10-6-13(7-11-15)19(22)23;;/h4-11H,1-3H2,(H3,20,21)(H3,22,23)(H,24,26)(H,25,27);2*1H |
| InChIKey | XLHRAUMVCPKEEP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 157.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|