C21H24N4O5 — CID 70261870
2-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-2-(4-hydroxyphenyl)butanoic acid (PubChem CID 70261870) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-2-(4-hydroxyphenyl)butanoic acid.
| Compound Name | 2-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-2-(4-hydroxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 70261870 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-2-(4-hydroxyphenyl)butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CCC(=O)NC(CC)(C(=O)O)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C21H24N4O5/c1-2-21(20(29)30,14-5-9-16(26)10-6-14)25-18(28)12-11-17(27)24-15-7-3-13(4-8-15)19(22)23/h3-10,26H,2,11-12H2,1H3,(H3,22,23)(H,24,27)(H,25,28)(H,29,30) |
| InChIKey | GYPMPZDMGWONEA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 165.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|