C24H30N4O4 — CID 67583765
5-(4-carbamimidoylanilino)-2-(4-methoxyphenyl)-5-oxo-2-piperidin-1-ylpentanoic acid (PubChem CID 67583765) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 5-(4-carbamimidoylanilino)-2-(4-methoxyphenyl)-5-oxo-2-piperidin-1-ylpentanoic acid.
| Compound Name | 5-(4-carbamimidoylanilino)-2-(4-methoxyphenyl)-5-oxo-2-piperidin-1-ylpentanoic acid |
|---|---|
| PubChem CID | 67583765 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 5-(4-carbamimidoylanilino)-2-(4-methoxyphenyl)-5-oxo-2-piperidin-1-ylpentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CCC(C(=O)O)(c2ccc(OC)cc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H30N4O4/c1-32-20-11-7-18(8-12-20)24(23(30)31,28-15-3-2-4-16-28)14-13-21(29)27-19-9-5-17(6-10-19)22(25)26/h5-12H,2-4,13-16H2,1H3,(H3,25,26)(H,27,29)(H,30,31) |
| InChIKey | FJDWUOQJDJGZBP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|