C19H26N4O4 — CID 56996933
ethyl 3-[2-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]cyclopropyl]propanoate (PubChem CID 56996933) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is ethyl 3-[2-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]cyclopropyl]propanoate.
| Compound Name | ethyl 3-[2-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]cyclopropyl]propanoate |
|---|---|
| PubChem CID | 56996933 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | ethyl 3-[2-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]cyclopropyl]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CCC(=O)NC2CC2CCC(=O)OCC)cc1 |
| InChI | InChI=1S/C19H26N4O4/c1-2-27-18(26)10-5-13-11-15(13)23-17(25)9-8-16(24)22-14-6-3-12(4-7-14)19(20)21/h3-4,6-7,13,15H,2,5,8-11H2,1H3,(H3,20,21)(H,22,24)(H,23,25) |
| InChIKey | MDJNGMFZEMJKFC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|