C22H28N4O4 — CID 90828737
N-(4-carbamimidoylphenyl)-N'-(2-hydroxyethyl)-N'-(2-propan-2-yloxyphenyl)butanediamide (PubChem CID 90828737) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N'-(2-hydroxyethyl)-N'-(2-propan-2-yloxyphenyl)butanediamide.
| Compound Name | N-(4-carbamimidoylphenyl)-N'-(2-hydroxyethyl)-N'-(2-propan-2-yloxyphenyl)butanediamide |
|---|---|
| PubChem CID | 90828737 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N'-(2-hydroxyethyl)-N'-(2-propan-2-yloxyphenyl)butanediamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CCC(=O)N(CCO)c2ccccc2OC(C)C)cc1 |
| InChI | InChI=1S/C22H28N4O4/c1-15(2)30-19-6-4-3-5-18(19)26(13-14-27)21(29)12-11-20(28)25-17-9-7-16(8-10-17)22(23)24/h3-10,15,27H,11-14H2,1-2H3,(H3,23,24)(H,25,28) |
| InChIKey | GFIZDJIPGSUBSZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|