C20H21N5O5 — CID 91238810
N-(4-carbamimidoylphenyl)-N'-(2-hydroxyethyl)-N'-(2-oxo-3H-1,3-benzoxazol-6-yl)butanediamide (PubChem CID 91238810) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N'-(2-hydroxyethyl)-N'-(2-oxo-3H-1,3-benzoxazol-6-yl)butanediamide.
| Compound Name | N-(4-carbamimidoylphenyl)-N'-(2-hydroxyethyl)-N'-(2-oxo-3H-1,3-benzoxazol-6-yl)butanediamide |
|---|---|
| PubChem CID | 91238810 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N'-(2-hydroxyethyl)-N'-(2-oxo-3H-1,3-benzoxazol-6-yl)butanediamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CCC(=O)N(CCO)c2ccc3[nH]c(=O)oc3c2)cc1 |
| InChI | InChI=1S/C20H21N5O5/c21-19(22)12-1-3-13(4-2-12)23-17(27)7-8-18(28)25(9-10-26)14-5-6-15-16(11-14)30-20(29)24-15/h1-6,11,26H,7-10H2,(H3,21,22)(H,23,27)(H,24,29) |
| InChIKey | LMRNZUCHQKOEFB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 165.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|