C22H27N5O5S — CID 90685408
N-(4-carbamimidoylphenyl)-N'-(3,3-dimethyl-2,2-dioxo-1H-2,1-benzothiazol-5-yl)-N'-(2-hydroxyethyl)butanediamide (PubChem CID 90685408) has the molecular formula C22H27N5O5S and a molecular weight of 473.56 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N'-(3,3-dimethyl-2,2-dioxo-1H-2,1-benzothiazol-5-yl)-N'-(2-hydroxyethyl)butanediamide.
| Compound Name | N-(4-carbamimidoylphenyl)-N'-(3,3-dimethyl-2,2-dioxo-1H-2,1-benzothiazol-5-yl)-N'-(2-hydroxyethyl)butanediamide |
|---|---|
| PubChem CID | 90685408 |
| Molecular Formula | C22H27N5O5S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N'-(3,3-dimethyl-2,2-dioxo-1H-2,1-benzothiazol-5-yl)-N'-(2-hydroxyethyl)butanediamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CCC(=O)N(CCO)c2ccc3c(c2)C(C)(C)S(=O)(=O)N3)cc1 |
| InChI | InChI=1S/C22H27N5O5S/c1-22(2)17-13-16(7-8-18(17)26-33(22,31)32)27(11-12-28)20(30)10-9-19(29)25-15-5-3-14(4-6-15)21(23)24/h3-8,13,26,28H,9-12H2,1-2H3,(H3,23,24)(H,25,29) |
| InChIKey | NOMISEZEEKDSNO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 165.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|