C19H19F3N4O4 — CID 91348656
N-(4-carbamimidoylphenyl)-2-hydroxy-N'-(2-hydroxyethyl)-N'-(3,4,5-trifluorophenyl)butanediamide (PubChem CID 91348656) has the molecular formula C19H19F3N4O4 and a molecular weight of 424.38 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-2-hydroxy-N'-(2-hydroxyethyl)-N'-(3,4,5-trifluorophenyl)butanediamide.
| Compound Name | N-(4-carbamimidoylphenyl)-2-hydroxy-N'-(2-hydroxyethyl)-N'-(3,4,5-trifluorophenyl)butanediamide |
|---|---|
| PubChem CID | 91348656 |
| Molecular Formula | C19H19F3N4O4 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-2-hydroxy-N'-(2-hydroxyethyl)-N'-(3,4,5-trifluorophenyl)butanediamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)C(O)CC(=O)N(CCO)c2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H19F3N4O4/c20-13-7-12(8-14(21)17(13)22)26(5-6-27)16(29)9-15(28)19(30)25-11-3-1-10(2-4-11)18(23)24/h1-4,7-8,15,27-28H,5-6,9H2,(H3,23,24)(H,25,30) |
| InChIKey | WJORLPMCIKRPOY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|