C24H29N5O4 — CID 70224818
N-(4-carbamimidoylphenyl)-N'-[4-[(2-cyclopropylacetyl)amino]phenyl]-N'-(2-hydroxyethyl)butanediamide (PubChem CID 70224818) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N'-[4-[(2-cyclopropylacetyl)amino]phenyl]-N'-(2-hydroxyethyl)butanediamide.
| Compound Name | N-(4-carbamimidoylphenyl)-N'-[4-[(2-cyclopropylacetyl)amino]phenyl]-N'-(2-hydroxyethyl)butanediamide |
|---|---|
| PubChem CID | 70224818 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N'-[4-[(2-cyclopropylacetyl)amino]phenyl]-N'-(2-hydroxyethyl)butanediamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CCC(=O)N(CCO)c2ccc(NC(=O)CC3CC3)cc2)cc1 |
| InChI | InChI=1S/C24H29N5O4/c25-24(26)17-3-5-18(6-4-17)27-21(31)11-12-23(33)29(13-14-30)20-9-7-19(8-10-20)28-22(32)15-16-1-2-16/h3-10,16,30H,1-2,11-15H2,(H3,25,26)(H,27,31)(H,28,32) |
| InChIKey | OWTNOLOAFXMVSL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 148.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|