C18H26N4O5 — CID 15432290
methyl 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-5-methoxypentanoate (PubChem CID 15432290) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is methyl 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-5-methoxypentanoate.
| Compound Name | methyl 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-5-methoxypentanoate |
|---|---|
| PubChem CID | 15432290 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | methyl 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-5-methoxypentanoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CCC(=O)NC(CCOC)CC(=O)OC)cc1 |
| InChI | InChI=1S/C18H26N4O5/c1-26-10-9-14(11-17(25)27-2)22-16(24)8-7-15(23)21-13-5-3-12(4-6-13)18(19)20/h3-6,14H,7-11H2,1-2H3,(H3,19,20)(H,21,23)(H,22,24) |
| InChIKey | YWVVPVLNHWYWJL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|