C24H28N6O7 — CID 54287325
methyl (3S)-3-acetamido-4-(N-[(1R)-1-[(4-carbamimidoylphenyl)carbamoylamino]-2-methoxy-2-oxoethyl]anilino)-4-oxobutanoate (PubChem CID 54287325) has the molecular formula C24H28N6O7 and a molecular weight of 512.52 g/mol. Its IUPAC name is methyl (3S)-3-acetamido-4-(N-[(1R)-1-[(4-carbamimidoylphenyl)carbamoylamino]-2-methoxy-2-oxoethyl]anilino)-4-oxobutanoate.
| Compound Name | methyl (3S)-3-acetamido-4-(N-[(1R)-1-[(4-carbamimidoylphenyl)carbamoylamino]-2-methoxy-2-oxoethyl]anilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 54287325 |
| Molecular Formula | C24H28N6O7 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | methyl (3S)-3-acetamido-4-(N-[(1R)-1-[(4-carbamimidoylphenyl)carbamoylamino]-2-methoxy-2-oxoethyl]anilino)-4-oxobutanoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)N[C@@H](C(=O)OC)N(C(=O)[C@H](CC(=O)OC)NC(C)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H28N6O7/c1-14(31)27-18(13-19(32)36-2)22(33)30(17-7-5-4-6-8-17)21(23(34)37-3)29-24(35)28-16-11-9-15(10-12-16)20(25)26/h4-12,18,21H,13H2,1-3H3,(H3,25,26)(H,27,31)(H2,28,29,35)/t18-,21+/m0/s1 |
| InChIKey | RVBFYAICBZLMGM-GHTZIAJQSA-N |
| XLogP | 0.69 |
| TPSA | 193.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|