C22H24N6O6S — CID 22880487
(3S)-3-amino-4-(N-[(2S)-1-[(4-carbamimidoylphenyl)carbamothioylamino]oxy-1,3-dioxobutan-2-yl]anilino)-4-oxobutanoic acid (PubChem CID 22880487) has the molecular formula C22H24N6O6S and a molecular weight of 500.54 g/mol. Its IUPAC name is (3S)-3-amino-4-(N-[(2S)-1-[(4-carbamimidoylphenyl)carbamothioylamino]oxy-1,3-dioxobutan-2-yl]anilino)-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-(N-[(2S)-1-[(4-carbamimidoylphenyl)carbamothioylamino]oxy-1,3-dioxobutan-2-yl]anilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22880487 |
| Molecular Formula | C22H24N6O6S |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | (3S)-3-amino-4-(N-[(2S)-1-[(4-carbamimidoylphenyl)carbamothioylamino]oxy-1,3-dioxobutan-2-yl]anilino)-4-oxobutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=S)NOC(=O)[C@H](C(C)=O)N(C(=O)[C@@H](N)CC(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H24N6O6S/c1-12(29)18(28(15-5-3-2-4-6-15)20(32)16(23)11-17(30)31)21(33)34-27-22(35)26-14-9-7-13(8-10-14)19(24)25/h2-10,16,18H,11,23H2,1H3,(H3,24,25)(H,30,31)(H2,26,27,35)/t16-,18-/m0/s1 |
| InChIKey | KZKWLENIGSTXQC-WMZOPIPTSA-N |
| XLogP | 0.51 |
| TPSA | 200.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|