C27H28N6O8 — CID 57159183
(3S)-3-amino-4-(N-[(2S)-1-[(4R)-4-(4-carbamimidoylphenyl)-4-cyclopropyl-2,5-dioxoimidazolidin-1-yl]oxy-1,3-dioxobutan-2-yl]anilino)-4-oxobutanoic acid (PubChem CID 57159183) has the molecular formula C27H28N6O8 and a molecular weight of 564.56 g/mol. Its IUPAC name is (3S)-3-amino-4-(N-[(2S)-1-[(4R)-4-(4-carbamimidoylphenyl)-4-cyclopropyl-2,5-dioxoimidazolidin-1-yl]oxy-1,3-dioxobutan-2-yl]anilino)-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-(N-[(2S)-1-[(4R)-4-(4-carbamimidoylphenyl)-4-cyclopropyl-2,5-dioxoimidazolidin-1-yl]oxy-1,3-dioxobutan-2-yl]anilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57159183 |
| Molecular Formula | C27H28N6O8 |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | (3S)-3-amino-4-(N-[(2S)-1-[(4R)-4-(4-carbamimidoylphenyl)-4-cyclopropyl-2,5-dioxoimidazolidin-1-yl]oxy-1,3-dioxobutan-2-yl]anilino)-4-oxobutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc([C@@]2(C3CC3)NC(=O)N(OC(=O)[C@H](C(C)=O)N(C(=O)[C@@H](N)CC(=O)O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H28N6O8/c1-14(34)21(32(18-5-3-2-4-6-18)23(37)19(28)13-20(35)36)24(38)41-33-25(39)27(17-11-12-17,31-26(33)40)16-9-7-15(8-10-16)22(29)30/h2-10,17,19,21H,11-13,28H2,1H3,(H3,29,30)(H,31,40)(H,35,36)/t19-,21-,27-/m0/s1 |
| InChIKey | PVOYLHIXFHDSOV-NJVGLYJLSA-N |
| XLogP | 0.38 |
| TPSA | 226.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|