C23H23N5O7 — CID 57242660
3-[(1R)-1-[acetyl-[(4R)-4-(4-carbamimidoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-carboxyethyl]benzoic acid (PubChem CID 57242660) has the molecular formula C23H23N5O7 and a molecular weight of 481.47 g/mol. Its IUPAC name is 3-[(1R)-1-[acetyl-[(4R)-4-(4-carbamimidoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-carboxyethyl]benzoic acid.
| Compound Name | 3-[(1R)-1-[acetyl-[(4R)-4-(4-carbamimidoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-carboxyethyl]benzoic acid |
|---|---|
| PubChem CID | 57242660 |
| Molecular Formula | C23H23N5O7 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 3-[(1R)-1-[acetyl-[(4R)-4-(4-carbamimidoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-carboxyethyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc([C@@]2(C)NC(=O)N(N(C(C)=O)[C@H](CC(=O)O)c3cccc(C(=O)O)c3)C2=O)cc1 |
| InChI | InChI=1S/C23H23N5O7/c1-12(29)27(17(11-18(30)31)14-4-3-5-15(10-14)20(32)33)28-21(34)23(2,26-22(28)35)16-8-6-13(7-9-16)19(24)25/h3-10,17H,11H2,1-2H3,(H3,24,25)(H,26,35)(H,30,31)(H,32,33)/t17-,23-/m1/s1 |
| InChIKey | VVNZCXQTCLNLED-UZUQRXQVSA-N |
| XLogP | 1.42 |
| TPSA | 194.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|