C19H28N4O4 — CID 67558756
(3S,6S)-3-amino-6-(4-carbamimidoylphenoxy)-6-(1-methylpiperidin-4-yl)-4-oxohexanoic acid (PubChem CID 67558756) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is (3S,6S)-3-amino-6-(4-carbamimidoylphenoxy)-6-(1-methylpiperidin-4-yl)-4-oxohexanoic acid.
| Compound Name | (3S,6S)-3-amino-6-(4-carbamimidoylphenoxy)-6-(1-methylpiperidin-4-yl)-4-oxohexanoic acid |
|---|---|
| PubChem CID | 67558756 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (3S,6S)-3-amino-6-(4-carbamimidoylphenoxy)-6-(1-methylpiperidin-4-yl)-4-oxohexanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(O[C@@H](CC(=O)[C@@H](N)CC(=O)O)C2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C19H28N4O4/c1-23-8-6-12(7-9-23)17(11-16(24)15(20)10-18(25)26)27-14-4-2-13(3-5-14)19(21)22/h2-5,12,15,17H,6-11,20H2,1H3,(H3,21,22)(H,25,26)/t15-,17-/m0/s1 |
| InChIKey | OAAYHHJTSCMMJF-RDJZCZTQSA-N |
| XLogP | 0.82 |
| TPSA | 142.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|