C14H22N4O — CID 57272065
4-(3-carbamimidoylhexan-2-yloxy)benzenecarboximidamide (PubChem CID 57272065) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-(3-carbamimidoylhexan-2-yloxy)benzenecarboximidamide.
| Compound Name | 4-(3-carbamimidoylhexan-2-yloxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 57272065 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 4-(3-carbamimidoylhexan-2-yloxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OC(C)C(CCC)/C(N)=N/[H])cc1 |
| InChI | InChI=1S/C14H22N4O/c1-3-4-12(14(17)18)9(2)19-11-7-5-10(6-8-11)13(15)16/h5-9,12H,3-4H2,1-2H3,(H3,15,16)(H3,17,18) |
| InChIKey | BNKPRSHSRYLPHU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|