C21H25N3O4 — CID 21130044
(4-carbamimidoylphenyl) 4-[2-oxo-2-(pentan-2-ylamino)ethoxy]benzoate (PubChem CID 21130044) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is (4-carbamimidoylphenyl) 4-[2-oxo-2-(pentan-2-ylamino)ethoxy]benzoate.
| Compound Name | (4-carbamimidoylphenyl) 4-[2-oxo-2-(pentan-2-ylamino)ethoxy]benzoate |
|---|---|
| PubChem CID | 21130044 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (4-carbamimidoylphenyl) 4-[2-oxo-2-(pentan-2-ylamino)ethoxy]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(OCC(=O)NC(C)CCC)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-3-4-14(2)24-19(25)13-27-17-9-7-16(8-10-17)21(26)28-18-11-5-15(6-12-18)20(22)23/h5-12,14H,3-4,13H2,1-2H3,(H3,22,23)(H,24,25) |
| InChIKey | YQEUTFVMVRYCDC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|