C27H32N4O9 — CID 134379721
2-[[5-[3-[4-(4-carbamimidoylphenoxy)carbonylphenoxy]propylamino]-5-oxopentanoyl]amino]pentanedioic acid (PubChem CID 134379721) has the molecular formula C27H32N4O9 and a molecular weight of 556.57 g/mol. Its IUPAC name is 2-[[5-[3-[4-(4-carbamimidoylphenoxy)carbonylphenoxy]propylamino]-5-oxopentanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[5-[3-[4-(4-carbamimidoylphenoxy)carbonylphenoxy]propylamino]-5-oxopentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 134379721 |
| Molecular Formula | C27H32N4O9 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 2-[[5-[3-[4-(4-carbamimidoylphenoxy)carbonylphenoxy]propylamino]-5-oxopentanoyl]amino]pentanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(OCCCNC(=O)CCCC(=O)NC(CCC(=O)O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H32N4O9/c28-25(29)17-5-11-20(12-6-17)40-27(38)18-7-9-19(10-8-18)39-16-2-15-30-22(32)3-1-4-23(33)31-21(26(36)37)13-14-24(34)35/h5-12,21H,1-4,13-16H2,(H3,28,29)(H,30,32)(H,31,33)(H,34,35)(H,36,37) |
| InChIKey | NQOULOKMTTXZFV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 218.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|