C32H46N6O7 — CID 159498051
6-[3-[4-(4-carbamimidoylphenoxy)carbonylphenoxy]propylcarbamoylamino]-2-[[2-methyl-6-(methylamino)hexanoyl]amino]hexanoic acid (PubChem CID 159498051) has the molecular formula C32H46N6O7 and a molecular weight of 626.76 g/mol. Its IUPAC name is 6-[3-[4-(4-carbamimidoylphenoxy)carbonylphenoxy]propylcarbamoylamino]-2-[[2-methyl-6-(methylamino)hexanoyl]amino]hexanoic acid.
| Compound Name | 6-[3-[4-(4-carbamimidoylphenoxy)carbonylphenoxy]propylcarbamoylamino]-2-[[2-methyl-6-(methylamino)hexanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 159498051 |
| Molecular Formula | C32H46N6O7 |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.34 |
| IUPAC Name | 6-[3-[4-(4-carbamimidoylphenoxy)carbonylphenoxy]propylcarbamoylamino]-2-[[2-methyl-6-(methylamino)hexanoyl]amino]hexanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(OCCCNC(=O)NCCCCC(NC(=O)C(C)CCCCNC)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C32H46N6O7/c1-22(8-3-5-18-35-2)29(39)38-27(30(40)41)9-4-6-19-36-32(43)37-20-7-21-44-25-14-12-24(13-15-25)31(42)45-26-16-10-23(11-17-26)28(33)34/h10-17,22,27,35H,3-9,18-21H2,1-2H3,(H3,33,34)(H,38,39)(H,40,41)(H2,36,37,43) |
| InChIKey | ATGMYMPLTSWGKY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 204.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|