C25H29N3O8 — CID 70013972
diethyl (2S)-2-[[2-[4-(4-carbamimidoylphenoxy)carbonylphenoxy]acetyl]amino]pentanedioate (PubChem CID 70013972) has the molecular formula C25H29N3O8 and a molecular weight of 499.52 g/mol. Its IUPAC name is diethyl (2S)-2-[[2-[4-(4-carbamimidoylphenoxy)carbonylphenoxy]acetyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[2-[4-(4-carbamimidoylphenoxy)carbonylphenoxy]acetyl]amino]pentanedioate |
|---|---|
| PubChem CID | 70013972 |
| Molecular Formula | C25H29N3O8 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | diethyl (2S)-2-[[2-[4-(4-carbamimidoylphenoxy)carbonylphenoxy]acetyl]amino]pentanedioate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(OCC(=O)N[C@@H](CCC(=O)OCC)C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C25H29N3O8/c1-3-33-22(30)14-13-20(25(32)34-4-2)28-21(29)15-35-18-9-7-17(8-10-18)24(31)36-19-11-5-16(6-12-19)23(26)27/h5-12,20H,3-4,13-15H2,1-2H3,(H3,26,27)(H,28,29)/t20-/m0/s1 |
| InChIKey | UXKBAAJQCSCVQB-FQEVSTJZSA-N |
| XLogP | 1.96 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|