C25H27N3O7 — CID 68561704
(4S)-4-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-5-ethoxy-5-oxopentanoic acid (PubChem CID 68561704) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is (4S)-4-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-5-ethoxy-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-5-ethoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 68561704 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (4S)-4-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-5-ethoxy-5-oxopentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(/C=C(\C)C(=O)N[C@@H](CCC(=O)O)C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O7/c1-3-34-25(33)20(12-13-21(29)30)28-23(31)15(2)14-16-4-6-18(7-5-16)24(32)35-19-10-8-17(9-11-19)22(26)27/h4-11,14,20H,3,12-13H2,1-2H3,(H3,26,27)(H,28,31)(H,29,30)/b15-14+/t20-/m0/s1 |
| InChIKey | BTDTXBUDOWPMSE-JWHUVLAVSA-N |
| XLogP | 2.51 |
| TPSA | 168.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|