C31H37N3O9 — CID 87498555
(2S)-2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-(3-ethoxy-3-oxopropyl)amino]-2,3-diethylbutanedioic acid (PubChem CID 87498555) has the molecular formula C31H37N3O9 and a molecular weight of 595.65 g/mol. Its IUPAC name is (2S)-2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-(3-ethoxy-3-oxopropyl)amino]-2,3-diethylbutanedioic acid.
| Compound Name | (2S)-2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-(3-ethoxy-3-oxopropyl)amino]-2,3-diethylbutanedioic acid |
|---|---|
| PubChem CID | 87498555 |
| Molecular Formula | C31H37N3O9 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | (2S)-2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-(3-ethoxy-3-oxopropyl)amino]-2,3-diethylbutanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(/C=C(\C)C(=O)N(CCC(=O)OCC)[C@](CC)(C(=O)O)C(CC)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C31H37N3O9/c1-5-24(28(37)38)31(6-2,30(40)41)34(17-16-25(35)42-7-3)27(36)19(4)18-20-8-10-22(11-9-20)29(39)43-23-14-12-21(13-15-23)26(32)33/h8-15,18,24H,5-7,16-17H2,1-4H3,(H3,32,33)(H,37,38)(H,40,41)/b19-18+/t24?,31-/m0/s1 |
| InChIKey | LWSDWMHNGUZQCP-DTRBWQKJSA-N |
| XLogP | 3.72 |
| TPSA | 197.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|